C9H15N — CID 91155902
7-azatricyclo[5.3.0.04,8]decane (PubChem CID 91155902) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 7-azatricyclo[5.3.0.04,8]decane.
| Compound Name | 7-azatricyclo[5.3.0.04,8]decane |
|---|---|
| PubChem CID | 91155902 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 7-azatricyclo[5.3.0.04,8]decane |
| SMILES | C1CC2CCC3C1CCN23 |
| InChI | InChI=1S/C9H15N/c1-2-8-3-4-9-7(1)5-6-10(8)9/h7-9H,1-6H2 |
| InChIKey | LCDBMHHGWMXMLB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |