C11H19N — CID 57261397
2-azatricyclo[5.3.2.02,6]dodecane (PubChem CID 57261397) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 2-azatricyclo[5.3.2.02,6]dodecane.
| Compound Name | 2-azatricyclo[5.3.2.02,6]dodecane |
|---|---|
| PubChem CID | 57261397 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2-azatricyclo[5.3.2.02,6]dodecane |
| SMILES | C1CC2CCC(C1)N1CCCC21 |
| InChI | InChI=1S/C11H19N/c1-3-9-6-7-10(4-1)12-8-2-5-11(9)12/h9-11H,1-8H2 |
| InChIKey | LGILRYAXNAHZDN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |