C14H27N — CID 14265442
8-methyl-5-pentyl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 14265442) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 8-methyl-5-pentyl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 8-methyl-5-pentyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 14265442 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 8-methyl-5-pentyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | CCCCCC1CCC(C)C2CCCN12 |
| InChI | InChI=1S/C14H27N/c1-3-4-5-7-13-10-9-12(2)14-8-6-11-15(13)14/h12-14H,3-11H2,1-2H3 |
| InChIKey | VISJLQLSCZBDKE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|