C13H24IN — CID 203045
Pyrido(1,2-a)indolium, dodecahydro-5-methyl-, iodide (PubChem CID 203045) has the molecular formula C13H24IN and a molecular weight of 321.24 g/mol. Its IUPAC name is 5-methyl-1,2,3,4,4a,6,7,8,9,9a,10,10a-dodecahydropyrido[1,2-a]indol-5-ium iodide.
| Compound Name | Pyrido(1,2-a)indolium, dodecahydro-5-methyl-, iodide |
|---|---|
| PubChem CID | 203045 |
| Molecular Formula | C13H24IN |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 5-methyl-1,2,3,4,4a,6,7,8,9,9a,10,10a-dodecahydropyrido[1,2-a]indol-5-ium iodide |
| SMILES | C[N+]12CCCCC1CC3C2CCCC3.[I-] |
| InChI | InChI=1S/C13H24N.HI/c1-14-9-5-4-7-12(14)10-11-6-2-3-8-13(11)14;/h11-13H,2-10H2,1H3;1H/q+1;/p-1 |
| InChIKey | SJRHDAMTQJPRLX-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | 225 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|