C11H10F3NO2 — CID 91159056
1,2,3,4-tetrahydroisoquinolin-4-yl 2,2,2-trifluoroacetate (PubChem CID 91159056) has the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinolin-4-yl 2,2,2-trifluoroacetate.
| Compound Name | 1,2,3,4-tetrahydroisoquinolin-4-yl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91159056 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinolin-4-yl 2,2,2-trifluoroacetate |
| SMILES | O=C(OC1CNCc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO2/c12-11(13,14)10(16)17-9-6-15-5-7-3-1-2-4-8(7)9/h1-4,9,15H,5-6H2 |
| InChIKey | CERBBLSMZANHBY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |