C13H20N2O — CID 91159247
3-N-(1,4-dimethylcyclohepta-2,4,6-trien-1-yl)-2-N,2-N-dimethyloxirane-2,3-diamine (PubChem CID 91159247) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-N-(1,4-dimethylcyclohepta-2,4,6-trien-1-yl)-2-N,2-N-dimethyloxirane-2,3-diamine.
| Compound Name | 3-N-(1,4-dimethylcyclohepta-2,4,6-trien-1-yl)-2-N,2-N-dimethyloxirane-2,3-diamine |
|---|---|
| PubChem CID | 91159247 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-N-(1,4-dimethylcyclohepta-2,4,6-trien-1-yl)-2-N,2-N-dimethyloxirane-2,3-diamine |
| SMILES | CC1=CC=CC(C)(NC2OC2N(C)C)C=C1 |
| InChI | InChI=1S/C13H20N2O/c1-10-6-5-8-13(2,9-7-10)14-11-12(16-11)15(3)4/h5-9,11-12,14H,1-4H3 |
| InChIKey | SHWSVQZCDXSEMV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 27.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|