C12H19NO — CID 91122924
N-(1-methoxyethyl)-1,4-dimethylcyclohepta-2,4,6-trien-1-amine (PubChem CID 91122924) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(1-methoxyethyl)-1,4-dimethylcyclohepta-2,4,6-trien-1-amine.
| Compound Name | N-(1-methoxyethyl)-1,4-dimethylcyclohepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 91122924 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(1-methoxyethyl)-1,4-dimethylcyclohepta-2,4,6-trien-1-amine |
| SMILES | COC(C)NC1(C)C=CC=C(C)C=C1 |
| InChI | InChI=1S/C12H19NO/c1-10-6-5-8-12(3,9-7-10)13-11(2)14-4/h5-9,11,13H,1-4H3 |
| InChIKey | NSOKMIBOSJOWHP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|