C13H23NO — CID 142857865
(2Z,4Z)-N-(2-ethoxyethyl)-4-methylocta-2,4,7-trien-1-amine (PubChem CID 142857865) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (2Z,4Z)-N-(2-ethoxyethyl)-4-methylocta-2,4,7-trien-1-amine.
| Compound Name | (2Z,4Z)-N-(2-ethoxyethyl)-4-methylocta-2,4,7-trien-1-amine |
|---|---|
| PubChem CID | 142857865 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2Z,4Z)-N-(2-ethoxyethyl)-4-methylocta-2,4,7-trien-1-amine |
| SMILES | C=CC/C=C(C)\C=C/CNCCOCC |
| InChI | InChI=1S/C13H23NO/c1-4-6-8-13(3)9-7-10-14-11-12-15-5-2/h4,7-9,14H,1,5-6,10-12H2,2-3H3/b9-7-,13-8- |
| InChIKey | GZZZBDSMMCIATR-XFSHKZRWSA-N |
| XLogP | 2.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|