About 2-aminoethyl 4-imino-2-methylpent-2-enoate
2-aminoethyl 4-imino-2-methylpent-2-enoate (PubChem CID 91159331) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-aminoethyl 4-imino-2-methylpent-2-enoate.
Molecular Properties
| Compound Name | 2-aminoethyl 4-imino-2-methylpent-2-enoate |
| PubChem CID | 91159331 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-aminoethyl 4-imino-2-methylpent-2-enoate |
| SMILES | [H]/N=C(\C)C=C(C)C(=O)OCCN |
| InChI | InChI=1S/C8H14N2O2/c1-6(5-7(2)10)8(11)12-4-3-9/h5,10H,3-4,9H2,1-2H3/b6-5?,10-7+ |
| InChIKey | OLSFHGATGLHEBI-JDVLXEGBSA-N |
| XLogP | 0.47 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl 4-imino-2-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 4-imino-2-methylpent-2-enoate?
The IUPAC name of 2-aminoethyl 4-imino-2-methylpent-2-enoate (CID 91159331) is 2-aminoethyl 4-imino-2-methylpent-2-enoate.
What is the SMILES notation for 2-aminoethyl 4-imino-2-methylpent-2-enoate?
The canonical SMILES for 2-aminoethyl 4-imino-2-methylpent-2-enoate is [H]/N=C(\C)C=C(C)C(=O)OCCN.
What is the InChIKey of 2-aminoethyl 4-imino-2-methylpent-2-enoate?
The InChIKey is OLSFHGATGLHEBI-JDVLXEGBSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-6(5-7(2)10)8(11)12-4-3-9/h5,10H,3-4,9H2,1-2H3/b6-5?,10-7+.
What are the key properties of 2-aminoethyl 4-imino-2-methylpent-2-enoate?
2-aminoethyl 4-imino-2-methylpent-2-enoate has a molecular weight of 170.21 g/mol, XLogP of 0.47, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 4-imino-2-methylpent-2-enoate is sourced from PubChem (CID 91159331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).