C9H15N3O2 — CID 90984314
methyl 5-amino-2-(3-aminoprop-1-enyl)-4-iminopent-2-enoate (PubChem CID 90984314) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is methyl 5-amino-2-(3-aminoprop-1-enyl)-4-iminopent-2-enoate.
| Compound Name | methyl 5-amino-2-(3-aminoprop-1-enyl)-4-iminopent-2-enoate |
|---|---|
| PubChem CID | 90984314 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | methyl 5-amino-2-(3-aminoprop-1-enyl)-4-iminopent-2-enoate |
| SMILES | [H]/N=C(/C=C(C=CCN)C(=O)OC)CN |
| InChI | InChI=1S/C9H15N3O2/c1-14-9(13)7(3-2-4-10)5-8(12)6-11/h2-3,5,12H,4,6,10-11H2,1H3/b3-2?,7-5?,12-8- |
| InChIKey | MVWNSUKIIBLWGP-DPPMXWFUSA-N |
| XLogP | -0.42 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|