C10H15N3O2 — CID 155698760
methanamine;methyl 3,4-diimino-6-methylcyclohexa-1,5-diene-1-carboxylate (PubChem CID 155698760) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is methanamine;methyl 3,4-diimino-6-methylcyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methanamine;methyl 3,4-diimino-6-methylcyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 155698760 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | methanamine;methyl 3,4-diimino-6-methylcyclohexa-1,5-diene-1-carboxylate |
| SMILES | CN.[H]/N=C1\C=C(C)C(C(=O)OC)=C\C1=N/[H] |
| InChI | InChI=1S/C9H10N2O2.CH5N/c1-5-3-7(10)8(11)4-6(5)9(12)13-2;1-2/h3-4,10-11H,1-2H3;2H2,1H3/b10-7+,11-8+; |
| InChIKey | VRTOWEOSARZTSP-YXFMPUTOSA-N |
| XLogP | 0.66 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|