C25H41N3O3S — CID 91163717
N-[1-(3-amino-3-cyclohexylpropyl)piperidin-4-yl]-2-(4-methylsulfonylphenyl)butanamide (PubChem CID 91163717) has the molecular formula C25H41N3O3S and a molecular weight of 463.69 g/mol. Its IUPAC name is N-[1-(3-amino-3-cyclohexylpropyl)piperidin-4-yl]-2-(4-methylsulfonylphenyl)butanamide.
| Compound Name | N-[1-(3-amino-3-cyclohexylpropyl)piperidin-4-yl]-2-(4-methylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 91163717 |
| Molecular Formula | C25H41N3O3S |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | N-[1-(3-amino-3-cyclohexylpropyl)piperidin-4-yl]-2-(4-methylsulfonylphenyl)butanamide |
| SMILES | CCC(C(=O)NC1CCN(CCC(N)C2CCCCC2)CC1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H41N3O3S/c1-3-23(19-9-11-22(12-10-19)32(2,30)31)25(29)27-21-13-16-28(17-14-21)18-15-24(26)20-7-5-4-6-8-20/h9-12,20-21,23-24H,3-8,13-18,26H2,1-2H3,(H,27,29) |
| InChIKey | MCQZYJQZBJPHEW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |