C9H16N2 — CID 91164354
N-methyl-N'-[(E)-4-methylpent-1-enyl]ethane-1,2-diimine (PubChem CID 91164354) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N-methyl-N'-[(E)-4-methylpent-1-enyl]ethane-1,2-diimine.
| Compound Name | N-methyl-N'-[(E)-4-methylpent-1-enyl]ethane-1,2-diimine |
|---|---|
| PubChem CID | 91164354 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N-methyl-N'-[(E)-4-methylpent-1-enyl]ethane-1,2-diimine |
| SMILES | C/N=C/C=N/C=C/CC(C)C |
| InChI | InChI=1S/C9H16N2/c1-9(2)5-4-6-11-8-7-10-3/h4,6-9H,5H2,1-3H3/b6-4+,10-7+,11-8+ |
| InChIKey | CFPCNDFGQCMTDW-UGBLYBQYSA-N |
| XLogP | 2.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|