C19H18N4O3 — CID 91164733
3-[(6,7-dimethoxy-1,2-dihydroindeno[1,2-c]pyrazol-3-yl)amino]benzamide (PubChem CID 91164733) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 3-[(6,7-dimethoxy-1,2-dihydroindeno[1,2-c]pyrazol-3-yl)amino]benzamide.
| Compound Name | 3-[(6,7-dimethoxy-1,2-dihydroindeno[1,2-c]pyrazol-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 91164733 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 3-[(6,7-dimethoxy-1,2-dihydroindeno[1,2-c]pyrazol-3-yl)amino]benzamide |
| SMILES | COc1cc2cc3c(Nc4cccc(C(N)=O)c4)[nH][nH]c-3c2cc1OC |
| InChI | InChI=1S/C19H18N4O3/c1-25-15-8-11-7-14-17(13(11)9-16(15)26-2)22-23-19(14)21-12-5-3-4-10(6-12)18(20)24/h3-9,21-23H,1-2H3,(H2,20,24) |
| InChIKey | CBGCQMIHQDKBGI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |