C53H95N — CID 91165905
7-[5-ethyl-2,5,8-trimethyl-3-[1-(1,4,7-trimethyl-5-bicyclo[7.1.0]decanyl)spiro[2.2]pentan-2-yl]cyclooctyl]-9,12,14-trimethylnonadec-16-en-1-imine (PubChem CID 91165905) has the molecular formula C53H95N and a molecular weight of 746.35 g/mol. Its IUPAC name is 7-[5-ethyl-2,5,8-trimethyl-3-[1-(1,4,7-trimethyl-5-bicyclo[7.1.0]decanyl)spiro[2.2]pentan-2-yl]cyclooctyl]-9,12,14-trimethylnonadec-16-en-1-imine.
| Compound Name | 7-[5-ethyl-2,5,8-trimethyl-3-[1-(1,4,7-trimethyl-5-bicyclo[7.1.0]decanyl)spiro[2.2]pentan-2-yl]cyclooctyl]-9,12,14-trimethylnonadec-16-en-1-imine |
|---|---|
| PubChem CID | 91165905 |
| Molecular Formula | C53H95N |
| Molecular Weight | 746.35 g/mol |
| Exact Mass | 745.75 |
| IUPAC Name | 7-[5-ethyl-2,5,8-trimethyl-3-[1-(1,4,7-trimethyl-5-bicyclo[7.1.0]decanyl)spiro[2.2]pentan-2-yl]cyclooctyl]-9,12,14-trimethylnonadec-16-en-1-imine |
| SMILES | [H]/N=C/CCCCCC(CC(C)CCC(C)CC(C)CC=CCC)C1C(C)CCC(C)(CC)CC(C2C(C3CC(C)CC4CC4(C)CCC3C)C23CC3)C1C |
| InChI | InChI=1S/C53H95N/c1-12-14-17-20-37(3)31-38(4)22-23-39(5)32-44(21-18-15-16-19-30-54)48-42(8)24-26-51(10,13-2)36-47(43(48)9)50-49(53(50)28-29-53)46-34-40(6)33-45-35-52(45,11)27-25-41(46)7/h14,17,30,37-50,54H,12-13,15-16,18-29,31-36H2,1-11H3/b17-14?,54-30+ |
| InChIKey | XAEMQMHDJKBGPQ-NWHBNMMESA-N |
| XLogP | 16.65 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.35 |
| LogP ≤ 5 | 16.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|