C21H33N — CID 123245329
[1,4,8-trimethyl-6-(1-methyl-2-propylcycloprop-2-en-1-yl)-2-bicyclo[7.1.0]dec-8-enyl]methanimine (PubChem CID 123245329) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is [1,4,8-trimethyl-6-(1-methyl-2-propylcycloprop-2-en-1-yl)-2-bicyclo[7.1.0]dec-8-enyl]methanimine.
| Compound Name | [1,4,8-trimethyl-6-(1-methyl-2-propylcycloprop-2-en-1-yl)-2-bicyclo[7.1.0]dec-8-enyl]methanimine |
|---|---|
| PubChem CID | 123245329 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | [1,4,8-trimethyl-6-(1-methyl-2-propylcycloprop-2-en-1-yl)-2-bicyclo[7.1.0]dec-8-enyl]methanimine |
| SMILES | [H]/N=C/C1CC(C)CC(C2(C)C=C2CCC)CC(C)=C2CC21C |
| InChI | InChI=1S/C21H33N/c1-6-7-16-11-20(16,4)17-8-14(2)9-18(13-22)21(5)12-19(21)15(3)10-17/h11,13-14,17-18,22H,6-10,12H2,1-5H3/b19-15?,22-13+ |
| InChIKey | WLZNNDSHAXXIBP-YYGQCMGPSA-N |
| XLogP | 6.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|