C23H41N — CID 91085247
N-ethyl-2-[(2-propylcyclopropylidene)methyl]-3-(1,2,5-trimethylcyclooctyl)propan-1-imine (PubChem CID 91085247) has the molecular formula C23H41N and a molecular weight of 331.59 g/mol. Its IUPAC name is N-ethyl-2-[(2-propylcyclopropylidene)methyl]-3-(1,2,5-trimethylcyclooctyl)propan-1-imine.
| Compound Name | N-ethyl-2-[(2-propylcyclopropylidene)methyl]-3-(1,2,5-trimethylcyclooctyl)propan-1-imine |
|---|---|
| PubChem CID | 91085247 |
| Molecular Formula | C23H41N |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.32 |
| IUPAC Name | N-ethyl-2-[(2-propylcyclopropylidene)methyl]-3-(1,2,5-trimethylcyclooctyl)propan-1-imine |
| SMILES | CCCC1CC1=CC(/C=N/CC)CC1(C)CCCC(C)CCC1C |
| InChI | InChI=1S/C23H41N/c1-6-9-21-15-22(21)14-20(17-24-7-2)16-23(5)13-8-10-18(3)11-12-19(23)4/h14,17-21H,6-13,15-16H2,1-5H3/b22-14?,24-17+ |
| InChIKey | WPRHJGRQGKCPGV-QWHUTSBQSA-N |
| XLogP | 7.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|