C16H27N — CID 123794453
(E)-5-methyl-3-[2-(1-methylcyclopropyl)ethyl]-N-prop-2-enylhex-2-en-1-imine (PubChem CID 123794453) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is (E)-5-methyl-3-[2-(1-methylcyclopropyl)ethyl]-N-prop-2-enylhex-2-en-1-imine.
| Compound Name | (E)-5-methyl-3-[2-(1-methylcyclopropyl)ethyl]-N-prop-2-enylhex-2-en-1-imine |
|---|---|
| PubChem CID | 123794453 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (E)-5-methyl-3-[2-(1-methylcyclopropyl)ethyl]-N-prop-2-enylhex-2-en-1-imine |
| SMILES | C=CC/N=C/C=C(\CCC1(C)CC1)CC(C)C |
| InChI | InChI=1S/C16H27N/c1-5-11-17-12-7-15(13-14(2)3)6-8-16(4)9-10-16/h5,7,12,14H,1,6,8-11,13H2,2-4H3/b15-7+,17-12+ |
| InChIKey | LYMSNKVUFLRYRR-HYYYZIJNSA-N |
| XLogP | 4.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|