C26H49N — CID 123342308
N-(2,7,10-triethyl-3,4,11-trimethyldodec-2-enyl)pent-2-en-1-imine (PubChem CID 123342308) has the molecular formula C26H49N and a molecular weight of 375.69 g/mol. Its IUPAC name is N-(2,7,10-triethyl-3,4,11-trimethyldodec-2-enyl)pent-2-en-1-imine.
| Compound Name | N-(2,7,10-triethyl-3,4,11-trimethyldodec-2-enyl)pent-2-en-1-imine |
|---|---|
| PubChem CID | 123342308 |
| Molecular Formula | C26H49N |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 375.39 |
| IUPAC Name | N-(2,7,10-triethyl-3,4,11-trimethyldodec-2-enyl)pent-2-en-1-imine |
| SMILES | CCC=C/C=N/CC(CC)=C(C)C(C)CCC(CC)CCC(CC)C(C)C |
| InChI | InChI=1S/C26H49N/c1-9-13-14-19-27-20-26(12-4)23(8)22(7)15-16-24(10-2)17-18-25(11-3)21(5)6/h13-14,19,21-22,24-25H,9-12,15-18,20H2,1-8H3/b14-13?,26-23?,27-19+ |
| InChIKey | HUUPPHTWEVYTMF-WHQOFNFQSA-N |
| XLogP | 8.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|