C20H37N — CID 162434682
(E)-5-[1,2-dimethyl-2-(2,2,3,3-tetramethylbutyl)cyclobutyl]-4-methylpent-3-en-1-imine (PubChem CID 162434682) has the molecular formula C20H37N and a molecular weight of 291.52 g/mol. Its IUPAC name is (E)-5-[1,2-dimethyl-2-(2,2,3,3-tetramethylbutyl)cyclobutyl]-4-methylpent-3-en-1-imine.
| Compound Name | (E)-5-[1,2-dimethyl-2-(2,2,3,3-tetramethylbutyl)cyclobutyl]-4-methylpent-3-en-1-imine |
|---|---|
| PubChem CID | 162434682 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | (E)-5-[1,2-dimethyl-2-(2,2,3,3-tetramethylbutyl)cyclobutyl]-4-methylpent-3-en-1-imine |
| SMILES | [H]/N=C/C/C=C(\C)CC1(C)CCC1(C)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H37N/c1-16(10-9-13-21)14-19(7)11-12-20(19,8)15-18(5,6)17(2,3)4/h10,13,21H,9,11-12,14-15H2,1-8H3/b16-10+,21-13+ |
| InChIKey | NMFHSAYEJCQAQC-INRPQCPQSA-N |
| XLogP | 6.63 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|