C12H19N — CID 123975814
3-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)propan-1-imine (PubChem CID 123975814) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 3-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)propan-1-imine.
| Compound Name | 3-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)propan-1-imine |
|---|---|
| PubChem CID | 123975814 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 3-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)propan-1-imine |
| SMILES | [H]/N=C/CCC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C12H19N/c1-12(2)10-6-5-9(4-3-7-13)11(12)8-10/h5,7,10-11,13H,3-4,6,8H2,1-2H3/b13-7+ |
| InChIKey | JEYFTXHFDDYRKM-NTUHNPAUSA-N |
| XLogP | 3.41 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|