C18H35N — CID 123840408
8-ethyl-3,9-dimethyl-7-propylundec-2-en-1-imine (PubChem CID 123840408) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is 8-ethyl-3,9-dimethyl-7-propylundec-2-en-1-imine.
| Compound Name | 8-ethyl-3,9-dimethyl-7-propylundec-2-en-1-imine |
|---|---|
| PubChem CID | 123840408 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 8-ethyl-3,9-dimethyl-7-propylundec-2-en-1-imine |
| SMILES | [H]/N=C/C=C(C)CCCC(CCC)C(CC)C(C)CC |
| InChI | InChI=1S/C18H35N/c1-6-10-17(18(8-3)16(5)7-2)12-9-11-15(4)13-14-19/h13-14,16-19H,6-12H2,1-5H3/b15-13?,19-14+ |
| InChIKey | FEENDAAKABLAHS-YQZQBXKSSA-N |
| XLogP | 6.24 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|