C21H41NO — CID 91751670
(E)-N-methoxy-3,7,11,15-tetramethylhexadec-2-en-1-imine (PubChem CID 91751670) has the molecular formula C21H41NO and a molecular weight of 323.56 g/mol. Its IUPAC name is (E)-N-methoxy-3,7,11,15-tetramethylhexadec-2-en-1-imine.
| Compound Name | (E)-N-methoxy-3,7,11,15-tetramethylhexadec-2-en-1-imine |
|---|---|
| PubChem CID | 91751670 |
| Molecular Formula | C21H41NO |
| Molecular Weight | 323.56 g/mol |
| Exact Mass | 323.32 |
| IUPAC Name | (E)-N-methoxy-3,7,11,15-tetramethylhexadec-2-en-1-imine |
| SMILES | CON=C/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C21H41NO/c1-18(2)10-7-11-19(3)12-8-13-20(4)14-9-15-21(5)16-17-22-23-6/h16-20H,7-15H2,1-6H3/b21-16+,22-17? |
| InChIKey | MVWDZTYQBOMLGA-BDXDXDMRSA-N |
| XLogP | 7.00 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.56 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|