C24H43N — CID 146481462
(2Z,4E)-3,11-diethyl-4,6,6,9-tetramethyl-7-methylidenepentadeca-2,4-dien-1-imine (PubChem CID 146481462) has the molecular formula C24H43N and a molecular weight of 345.62 g/mol. Its IUPAC name is (2Z,4E)-3,11-diethyl-4,6,6,9-tetramethyl-7-methylidenepentadeca-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-3,11-diethyl-4,6,6,9-tetramethyl-7-methylidenepentadeca-2,4-dien-1-imine |
|---|---|
| PubChem CID | 146481462 |
| Molecular Formula | C24H43N |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.34 |
| IUPAC Name | (2Z,4E)-3,11-diethyl-4,6,6,9-tetramethyl-7-methylidenepentadeca-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C(CC)\C(C)=C\C(C)(C)C(=C)CC(C)CC(CC)CCCC |
| InChI | InChI=1S/C24H43N/c1-9-12-13-22(10-2)17-19(4)16-21(6)24(7,8)18-20(5)23(11-3)14-15-25/h14-15,18-19,22,25H,6,9-13,16-17H2,1-5,7-8H3/b20-18+,23-14-,25-15+ |
| InChIKey | YZXZGRJFGXIFPV-TVFLACLQSA-N |
| XLogP | 8.13 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|