C17H27N — CID 91300856
[4-[2-(2-ethylbutyl)-1-methylcyclopropyl]cyclohexa-1,3-dien-1-yl]methanimine (PubChem CID 91300856) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is [4-[2-(2-ethylbutyl)-1-methylcyclopropyl]cyclohexa-1,3-dien-1-yl]methanimine.
| Compound Name | [4-[2-(2-ethylbutyl)-1-methylcyclopropyl]cyclohexa-1,3-dien-1-yl]methanimine |
|---|---|
| PubChem CID | 91300856 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | [4-[2-(2-ethylbutyl)-1-methylcyclopropyl]cyclohexa-1,3-dien-1-yl]methanimine |
| SMILES | [H]/N=C/C1=CC=C(C2(C)CC2CC(CC)CC)CC1 |
| InChI | InChI=1S/C17H27N/c1-4-13(5-2)10-16-11-17(16,3)15-8-6-14(12-18)7-9-15/h6,8,12-13,16,18H,4-5,7,9-11H2,1-3H3/b18-12+ |
| InChIKey | CJDSKQDWKYNCLW-LDADJPATSA-N |
| XLogP | 5.14 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|