C10H18OS — CID 911670
1-[(4S)-2,2-dimethylthian-4-yl]propan-1-one (PubChem CID 911670) has the molecular formula C10H18OS and a molecular weight of 186.32 g/mol. Its IUPAC name is 1-[(4S)-2,2-dimethylthian-4-yl]propan-1-one.
| Compound Name | 1-[(4S)-2,2-dimethylthian-4-yl]propan-1-one |
|---|---|
| PubChem CID | 911670 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 1-[(4S)-2,2-dimethylthian-4-yl]propan-1-one |
| SMILES | CCC(=O)[C@H]1CCSC(C)(C)C1 |
| InChI | InChI=1S/C10H18OS/c1-4-9(11)8-5-6-12-10(2,3)7-8/h8H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | IZAVQVDUYWGIPE-QMMMGPOBSA-N |
| XLogP | 2.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |