C12H22OS — CID 911893
1-[(2R,4S)-2-ethyl-2-methylthian-4-yl]butan-1-one (PubChem CID 911893) has the molecular formula C12H22OS and a molecular weight of 214.37 g/mol. Its IUPAC name is 1-[(2R,4S)-2-ethyl-2-methylthian-4-yl]butan-1-one.
| Compound Name | 1-[(2R,4S)-2-ethyl-2-methylthian-4-yl]butan-1-one |
|---|---|
| PubChem CID | 911893 |
| Molecular Formula | C12H22OS |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-[(2R,4S)-2-ethyl-2-methylthian-4-yl]butan-1-one |
| SMILES | CCCC(=O)[C@H]1CCS[C@](C)(CC)C1 |
| InChI | InChI=1S/C12H22OS/c1-4-6-11(13)10-7-8-14-12(3,5-2)9-10/h10H,4-9H2,1-3H3/t10-,12+/m0/s1 |
| InChIKey | AQHZXLJFFKBUKN-CMPLNLGQSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |