C11H10N4O4 — CID 91167256
[1-(2,4-dioxo-1,3-benzoxazin-6-yl)ethylideneamino]urea (PubChem CID 91167256) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is [1-(2,4-dioxo-1,3-benzoxazin-6-yl)ethylideneamino]urea.
| Compound Name | [1-(2,4-dioxo-1,3-benzoxazin-6-yl)ethylideneamino]urea |
|---|---|
| PubChem CID | 91167256 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | [1-(2,4-dioxo-1,3-benzoxazin-6-yl)ethylideneamino]urea |
| SMILES | CC(=NNC(N)=O)c1ccc2oc(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C11H10N4O4/c1-5(14-15-10(12)17)6-2-3-8-7(4-6)9(16)13-11(18)19-8/h2-4H,1H3,(H3,12,15,17)(H,13,16,18) |
| InChIKey | IHZVBJPUFFDEIF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|