C25H27FN2O3 — CID 91167627
N-(4-cyclohexylphenyl)-5-[(3-fluorophenyl)methyl]-5-methyl-2,4-dioxopyrrolidine-3-carboxamide (PubChem CID 91167627) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)-5-[(3-fluorophenyl)methyl]-5-methyl-2,4-dioxopyrrolidine-3-carboxamide.
| Compound Name | N-(4-cyclohexylphenyl)-5-[(3-fluorophenyl)methyl]-5-methyl-2,4-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 91167627 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-(4-cyclohexylphenyl)-5-[(3-fluorophenyl)methyl]-5-methyl-2,4-dioxopyrrolidine-3-carboxamide |
| SMILES | CC1(Cc2cccc(F)c2)NC(=O)C(C(=O)Nc2ccc(C3CCCCC3)cc2)C1=O |
| InChI | InChI=1S/C25H27FN2O3/c1-25(15-16-6-5-9-19(26)14-16)22(29)21(24(31)28-25)23(30)27-20-12-10-18(11-13-20)17-7-3-2-4-8-17/h5-6,9-14,17,21H,2-4,7-8,15H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | QVQKMHGULAMFPW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|