C19H17ClN4O3 — CID 9117000
N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-2-(4-oxo-3H-phthalazin-1-yl)acetamide (PubChem CID 9117000) has the molecular formula C19H17ClN4O3 and a molecular weight of 384.82 g/mol. Its IUPAC name is N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-2-(4-oxo-3H-phthalazin-1-yl)acetamide.
| Compound Name | N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
|---|---|
| PubChem CID | 9117000 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[2-(3-chloro-2-methylanilino)-2-oxoethyl]-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CNC(=O)Cc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H17ClN4O3/c1-11-14(20)7-4-8-15(11)22-18(26)10-21-17(25)9-16-12-5-2-3-6-13(12)19(27)24-23-16/h2-8H,9-10H2,1H3,(H,21,25)(H,22,26)(H,24,27) |
| InChIKey | WSJLNCIJJOOKMW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |