C9H5F2NO2 — CID 91170766
2-(2,3-difluorophenoxy)-1,3-oxazole (PubChem CID 91170766) has the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. Its IUPAC name is 2-(2,3-difluorophenoxy)-1,3-oxazole.
| Compound Name | 2-(2,3-difluorophenoxy)-1,3-oxazole |
|---|---|
| PubChem CID | 91170766 |
| Molecular Formula | C9H5F2NO2 |
| Molecular Weight | 197.14 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 2-(2,3-difluorophenoxy)-1,3-oxazole |
| SMILES | Fc1cccc(Oc2ncco2)c1F |
| InChI | InChI=1S/C9H5F2NO2/c10-6-2-1-3-7(8(6)11)14-9-12-4-5-13-9/h1-5H |
| InChIKey | HCEHCSLCEPTKIB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.14 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |