C17H19N5O — CID 91170807
4-[imidazo[1,2-a]pyrazin-8-yl(pyridin-3-yl)amino]cyclohexan-1-ol (PubChem CID 91170807) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-[imidazo[1,2-a]pyrazin-8-yl(pyridin-3-yl)amino]cyclohexan-1-ol.
| Compound Name | 4-[imidazo[1,2-a]pyrazin-8-yl(pyridin-3-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 91170807 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 4-[imidazo[1,2-a]pyrazin-8-yl(pyridin-3-yl)amino]cyclohexan-1-ol |
| SMILES | OC1CCC(N(c2cccnc2)c2nccn3ccnc23)CC1 |
| InChI | InChI=1S/C17H19N5O/c23-15-5-3-13(4-6-15)22(14-2-1-7-18-12-14)17-16-19-8-10-21(16)11-9-20-17/h1-2,7-13,15,23H,3-6H2 |
| InChIKey | LLBWBDCWHVYWKU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |