C23H26N4O4 — CID 9117284
3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-(4-methoxyanilino)phenyl]propanamide (PubChem CID 9117284) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-(4-methoxyanilino)phenyl]propanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-(4-methoxyanilino)phenyl]propanamide |
|---|---|
| PubChem CID | 9117284 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[2-(4-methoxyanilino)phenyl]propanamide |
| SMILES | COc1ccc(Nc2ccccc2NC(=O)CCN2C(=O)NC3(CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H26N4O4/c1-31-17-10-8-16(9-11-17)24-18-6-2-3-7-19(18)25-20(28)12-15-27-21(29)23(26-22(27)30)13-4-5-14-23/h2-3,6-11,24H,4-5,12-15H2,1H3,(H,25,28)(H,26,30) |
| InChIKey | CGYLPKMDDWLHEX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|