C18H36O — CID 91173676
3,3,6,8,9,9,10-heptamethylundecan-4-one (PubChem CID 91173676) has the molecular formula C18H36O and a molecular weight of 268.48 g/mol. Its IUPAC name is 3,3,6,8,9,9,10-heptamethylundecan-4-one.
| Compound Name | 3,3,6,8,9,9,10-heptamethylundecan-4-one |
|---|---|
| PubChem CID | 91173676 |
| Molecular Formula | C18H36O |
| Molecular Weight | 268.48 g/mol |
| Exact Mass | 268.28 |
| IUPAC Name | 3,3,6,8,9,9,10-heptamethylundecan-4-one |
| SMILES | CCC(C)(C)C(=O)CC(C)CC(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C18H36O/c1-10-17(6,7)16(19)12-14(4)11-15(5)18(8,9)13(2)3/h13-15H,10-12H2,1-9H3 |
| InChIKey | XUFTXPNAWUXBNL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |