C26H28ClF3N4O6S — CID 91174998
3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-propan-2-yloxyphenyl]propyl N-(2-pyridin-2-ylethylsulfamoyl)carbamate (PubChem CID 91174998) has the molecular formula C26H28ClF3N4O6S and a molecular weight of 617.05 g/mol. Its IUPAC name is 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-propan-2-yloxyphenyl]propyl N-(2-pyridin-2-ylethylsulfamoyl)carbamate.
| Compound Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-propan-2-yloxyphenyl]propyl N-(2-pyridin-2-ylethylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 91174998 |
| Molecular Formula | C26H28ClF3N4O6S |
| Molecular Weight | 617.05 g/mol |
| Exact Mass | 616.14 |
| IUPAC Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-propan-2-yloxyphenyl]propyl N-(2-pyridin-2-ylethylsulfamoyl)carbamate |
| SMILES | CC(C)Oc1cccc(CCCOC(=O)NS(=O)(=O)NCCc2ccccn2)c1Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C26H28ClF3N4O6S/c1-17(2)39-22-10-5-7-18(23(22)40-24-21(27)15-19(16-32-24)26(28,29)30)8-6-14-38-25(35)34-41(36,37)33-13-11-20-9-3-4-12-31-20/h3-5,7,9-10,12,15-17,33H,6,8,11,13-14H2,1-2H3,(H,34,35) |
| InChIKey | XKWLXXHKVBDJIK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.05 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|