C12H15BrN4OS2 — CID 91175246
ethane;methyl N-[(6-bromoimidazo[1,2-a]pyridine-3-carbonyl)amino]carbamodithioate (PubChem CID 91175246) has the molecular formula C12H15BrN4OS2 and a molecular weight of 375.32 g/mol. Its IUPAC name is ethane;methyl N-[(6-bromoimidazo[1,2-a]pyridine-3-carbonyl)amino]carbamodithioate.
| Compound Name | ethane;methyl N-[(6-bromoimidazo[1,2-a]pyridine-3-carbonyl)amino]carbamodithioate |
|---|---|
| PubChem CID | 91175246 |
| Molecular Formula | C12H15BrN4OS2 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | ethane;methyl N-[(6-bromoimidazo[1,2-a]pyridine-3-carbonyl)amino]carbamodithioate |
| SMILES | CC.CSC(=S)NNC(=O)c1cnc2ccc(Br)cn12 |
| InChI | InChI=1S/C10H9BrN4OS2.C2H6/c1-18-10(17)14-13-9(16)7-4-12-8-3-2-6(11)5-15(7)8;1-2/h2-5H,1H3,(H,13,16)(H,14,17);1-2H3 |
| InChIKey | JHRZFIXYQFOVNU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|