C20H19F2NO5 — CID 91175388
methyl 4-[2-(4-fluorophenoxy)ethyl-[(4-fluorophenyl)methyl]amino]-2,4-dioxobutanoate (PubChem CID 91175388) has the molecular formula C20H19F2NO5 and a molecular weight of 391.37 g/mol. Its IUPAC name is methyl 4-[2-(4-fluorophenoxy)ethyl-[(4-fluorophenyl)methyl]amino]-2,4-dioxobutanoate.
| Compound Name | methyl 4-[2-(4-fluorophenoxy)ethyl-[(4-fluorophenyl)methyl]amino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 91175388 |
| Molecular Formula | C20H19F2NO5 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | methyl 4-[2-(4-fluorophenoxy)ethyl-[(4-fluorophenyl)methyl]amino]-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)N(CCOc1ccc(F)cc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H19F2NO5/c1-27-20(26)18(24)12-19(25)23(13-14-2-4-15(21)5-3-14)10-11-28-17-8-6-16(22)7-9-17/h2-9H,10-13H2,1H3 |
| InChIKey | PIHYOWHBUCLMBO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|