C20H26FIN2O — CID 91175656
1-[(3R)-3-(4-fluorophenyl)-8-(3-iodoprop-2-enyl)-8-azabicyclo[3.2.1]octan-2-ylidene]-N-methoxypropan-1-amine (PubChem CID 91175656) has the molecular formula C20H26FIN2O and a molecular weight of 456.34 g/mol. Its IUPAC name is 1-[(3R)-3-(4-fluorophenyl)-8-(3-iodoprop-2-enyl)-8-azabicyclo[3.2.1]octan-2-ylidene]-N-methoxypropan-1-amine.
| Compound Name | 1-[(3R)-3-(4-fluorophenyl)-8-(3-iodoprop-2-enyl)-8-azabicyclo[3.2.1]octan-2-ylidene]-N-methoxypropan-1-amine |
|---|---|
| PubChem CID | 91175656 |
| Molecular Formula | C20H26FIN2O |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 1-[(3R)-3-(4-fluorophenyl)-8-(3-iodoprop-2-enyl)-8-azabicyclo[3.2.1]octan-2-ylidene]-N-methoxypropan-1-amine |
| SMILES | CCC(NOC)=C1C2CCC(C[C@@H]1c1ccc(F)cc1)N2CC=CI |
| InChI | InChI=1S/C20H26FIN2O/c1-3-18(23-25-2)20-17(14-5-7-15(21)8-6-14)13-16-9-10-19(20)24(16)12-4-11-22/h4-8,11,16-17,19,23H,3,9-10,12-13H2,1-2H3/t16?,17-,19?/m1/s1 |
| InChIKey | ZZQYVBNDJJDOCR-TVRKMHQQSA-N |
| XLogP | 4.91 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|