About CID 91175686
CID 91175686 (PubChem CID 91175686) has the molecular formula C19H34B3O13P3S3
and a molecular weight of 692.03 g/mol.
Molecular Properties
| Compound Name | CID 91175686 |
| PubChem CID | 91175686 |
| Molecular Formula | C19H34B3O13P3S3 |
| Molecular Weight | 692.03 g/mol |
| Exact Mass | 692.07 |
| IUPAC Name | — |
| SMILES | [B]C1CC(OP(O)(=S)OCC2OC([B])CC2OP(O)(=S)OCC2OC([B])CC2OP(O)(=S)OCC)C(COCC)O1 |
| InChI | InChI=1S/C19H34B3O13P3S3/c1-3-26-8-14-11(5-17(20)30-14)34-37(24,40)28-10-16-13(7-19(22)32-16)35-38(25,41)29-9-15-12(6-18(21)31-15)33-36(23,39)27-4-2/h11-19H,3-10H2,1-2H3,(H,23,39)(H,24,40)(H,25,41) |
| InChIKey | JHHKCXUXWUTDDS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 692.03 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 91175686 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91175686?
The IUPAC name of CID 91175686 (CID 91175686) is not available.
What is the SMILES notation for CID 91175686?
The canonical SMILES for CID 91175686 is [B]C1CC(OP(O)(=S)OCC2OC([B])CC2OP(O)(=S)OCC2OC([B])CC2OP(O)(=S)OCC)C(COCC)O1.
What is the InChIKey of CID 91175686?
The InChIKey is JHHKCXUXWUTDDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34B3O13P3S3/c1-3-26-8-14-11(5-17(20)30-14)34-37(24,40)28-10-16-13(7-19(22)32-16)35-38(25,41)29-9-15-12(6-18(21)31-15)33-36(23,39)27-4-2/h11-19H,3-10H2,1-2H3,(H,23,39)(H,24,40)(H,25,41).
What are the key properties of CID 91175686?
CID 91175686 has a molecular weight of 692.03 g/mol, XLogP of 0.75, 17 rotatable bonds, 3 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91175686 is sourced from PubChem (CID 91175686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).