C11H20BO7PS — CID 161101261
CID 161101261 (PubChem CID 161101261) has the molecular formula C11H20BO7PS and a molecular weight of 338.13 g/mol.
| Compound Name | CID 161101261 |
|---|---|
| PubChem CID | 161101261 |
| Molecular Formula | C11H20BO7PS |
| Molecular Weight | 338.13 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@@H](OP(O)(=S)OC[C@H]2O[C@@H](C)C[C@H]2O)[C@@H](CO)O1 |
| InChI | InChI=1S/C11H20BO7PS/c1-6-2-7(14)10(17-6)5-16-20(15,21)19-8-3-11(12)18-9(8)4-13/h6-11,13-14H,2-5H2,1H3,(H,15,21)/t6-,7+,8+,9+,10+,11+,20?/m0/s1 |
| InChIKey | ZEVVDSIREODQMA-FBZQLWKRSA-N |
| XLogP | -0.58 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.13 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|