C14H26O7 — CID 91175777
1-[(2S,3R,4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxy-2-pentoxyoxolan-3-yl]propan-1-one (PubChem CID 91175777) has the molecular formula C14H26O7 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxy-2-pentoxyoxolan-3-yl]propan-1-one.
| Compound Name | 1-[(2S,3R,4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxy-2-pentoxyoxolan-3-yl]propan-1-one |
|---|---|
| PubChem CID | 91175777 |
| Molecular Formula | C14H26O7 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-[(2S,3R,4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxy-2-pentoxyoxolan-3-yl]propan-1-one |
| SMILES | CCCCCO[C@H]1O[C@H]([C@H](O)CO)[C@H](O)[C@]1(O)C(=O)CC |
| InChI | InChI=1S/C14H26O7/c1-3-5-6-7-20-13-14(19,10(17)4-2)12(18)11(21-13)9(16)8-15/h9,11-13,15-16,18-19H,3-8H2,1-2H3/t9-,11-,12+,13+,14-/m1/s1 |
| InChIKey | XSLTXLYDWFQWCT-QKGWFMCXSA-N |
| XLogP | -0.66 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|