C9H16O — CID 91176144
3,5-dimethyl-2-prop-2-enyloxolane (PubChem CID 91176144) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is 3,5-dimethyl-2-prop-2-enyloxolane.
| Compound Name | 3,5-dimethyl-2-prop-2-enyloxolane |
|---|---|
| PubChem CID | 91176144 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 3,5-dimethyl-2-prop-2-enyloxolane |
| SMILES | C=CCC1OC(C)CC1C |
| InChI | InChI=1S/C9H16O/c1-4-5-9-7(2)6-8(3)10-9/h4,7-9H,1,5-6H2,2-3H3 |
| InChIKey | BWCKZGXZWAUDNW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|