C13H26O — CID 15247708
(4S,5S)-4-methyl-5-[(2-methylpropan-2-yl)oxy]oct-1-ene (PubChem CID 15247708) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is (4S,5S)-4-methyl-5-[(2-methylpropan-2-yl)oxy]oct-1-ene.
| Compound Name | (4S,5S)-4-methyl-5-[(2-methylpropan-2-yl)oxy]oct-1-ene |
|---|---|
| PubChem CID | 15247708 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | (4S,5S)-4-methyl-5-[(2-methylpropan-2-yl)oxy]oct-1-ene |
| SMILES | C=CC[C@H](C)[C@H](CCC)OC(C)(C)C |
| InChI | InChI=1S/C13H26O/c1-7-9-11(3)12(10-8-2)14-13(4,5)6/h7,11-12H,1,8-10H2,2-6H3/t11-,12-/m0/s1 |
| InChIKey | QGQMROQXNVQHNX-RYUDHWBXSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|