C14H28O — CID 15668626
(3S,4S,5S)-3,4-dimethyl-5-[(2-methylpropan-2-yl)oxy]oct-1-ene (PubChem CID 15668626) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is (3S,4S,5S)-3,4-dimethyl-5-[(2-methylpropan-2-yl)oxy]oct-1-ene.
| Compound Name | (3S,4S,5S)-3,4-dimethyl-5-[(2-methylpropan-2-yl)oxy]oct-1-ene |
|---|---|
| PubChem CID | 15668626 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | (3S,4S,5S)-3,4-dimethyl-5-[(2-methylpropan-2-yl)oxy]oct-1-ene |
| SMILES | C=C[C@H](C)[C@H](C)[C@H](CCC)OC(C)(C)C |
| InChI | InChI=1S/C14H28O/c1-8-10-13(15-14(5,6)7)12(4)11(3)9-2/h9,11-13H,2,8,10H2,1,3-7H3/t11-,12-,13-/m0/s1 |
| InChIKey | QYJWMKSCQXYFFB-AVGNSLFASA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|