C7H12 — CID 91176619
1,3-dimethylbicyclo[2.1.0]pentane (PubChem CID 91176619) has the molecular formula C7H12 and a molecular weight of 96.17 g/mol. Its IUPAC name is 1,3-dimethylbicyclo[2.1.0]pentane.
| Compound Name | 1,3-dimethylbicyclo[2.1.0]pentane |
|---|---|
| PubChem CID | 91176619 |
| Molecular Formula | C7H12 |
| Molecular Weight | 96.17 g/mol |
| Exact Mass | 96.09 |
| IUPAC Name | 1,3-dimethylbicyclo[2.1.0]pentane |
| SMILES | CC1CC2(C)CC12 |
| InChI | InChI=1S/C7H12/c1-5-3-7(2)4-6(5)7/h5-6H,3-4H2,1-2H3 |
| InChIKey | RFZNBPMLLJGPPD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |