C12H20N2 — CID 91176798
N-(6-butan-2-yl-2,3-dihydropyridin-5-yl)propan-1-imine (PubChem CID 91176798) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N-(6-butan-2-yl-2,3-dihydropyridin-5-yl)propan-1-imine.
| Compound Name | N-(6-butan-2-yl-2,3-dihydropyridin-5-yl)propan-1-imine |
|---|---|
| PubChem CID | 91176798 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-(6-butan-2-yl-2,3-dihydropyridin-5-yl)propan-1-imine |
| SMILES | CC/C=N/C1=CCCN=C1C(C)CC |
| InChI | InChI=1S/C12H20N2/c1-4-8-13-11-7-6-9-14-12(11)10(3)5-2/h7-8,10H,4-6,9H2,1-3H3/b13-8+ |
| InChIKey | LDGIDHXMRUTLPO-MDWZMJQESA-N |
| XLogP | 3.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|