C11H16N2 — CID 91242003
10-methyl-2,3,7,8,9,10-hexahydropyrido[3,2-b]azocine (PubChem CID 91242003) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 10-methyl-2,3,7,8,9,10-hexahydropyrido[3,2-b]azocine.
| Compound Name | 10-methyl-2,3,7,8,9,10-hexahydropyrido[3,2-b]azocine |
|---|---|
| PubChem CID | 91242003 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 10-methyl-2,3,7,8,9,10-hexahydropyrido[3,2-b]azocine |
| SMILES | CC1CCC/C=N\C2=CCCN=C21 |
| InChI | InChI=1S/C11H16N2/c1-9-5-2-3-7-12-10-6-4-8-13-11(9)10/h6-7,9H,2-5,8H2,1H3/b12-7- |
| InChIKey | LVSFARKJFLVRMK-GHXNOFRVSA-N |
| XLogP | 2.61 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |