C24H30N2O3 — CID 91178234
[2-[(1-cyclopentylpropan-2-ylamino)methyl]phenyl] N-(4-acetylphenyl)carbamate (PubChem CID 91178234) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is [2-[(1-cyclopentylpropan-2-ylamino)methyl]phenyl] N-(4-acetylphenyl)carbamate.
| Compound Name | [2-[(1-cyclopentylpropan-2-ylamino)methyl]phenyl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 91178234 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | [2-[(1-cyclopentylpropan-2-ylamino)methyl]phenyl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)Oc2ccccc2CNC(C)CC2CCCC2)cc1 |
| InChI | InChI=1S/C24H30N2O3/c1-17(15-19-7-3-4-8-19)25-16-21-9-5-6-10-23(21)29-24(28)26-22-13-11-20(12-14-22)18(2)27/h5-6,9-14,17,19,25H,3-4,7-8,15-16H2,1-2H3,(H,26,28) |
| InChIKey | BTLPQUWZAPCTNE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |