C9H9FN2O2S — CID 91179727
N-[4-(cyanomethyl)-2-fluorophenyl]methanesulfonamide (PubChem CID 91179727) has the molecular formula C9H9FN2O2S and a molecular weight of 228.25 g/mol. Its IUPAC name is N-[4-(cyanomethyl)-2-fluorophenyl]methanesulfonamide.
| Compound Name | N-[4-(cyanomethyl)-2-fluorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 91179727 |
| Molecular Formula | C9H9FN2O2S |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | N-[4-(cyanomethyl)-2-fluorophenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(CC#N)cc1F |
| InChI | InChI=1S/C9H9FN2O2S/c1-15(13,14)12-9-3-2-7(4-5-11)6-8(9)10/h2-3,6,12H,4H2,1H3 |
| InChIKey | KJFIGORCHWLJCD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |