C28H34FN3O4 — CID 91181051
methyl (2S)-2-cyclohexyl-2-[[2-[(2,6-dimethyl-4-prop-2-enylphenyl)carbamoylamino]-4-fluorobenzoyl]amino]acetate (PubChem CID 91181051) has the molecular formula C28H34FN3O4 and a molecular weight of 495.60 g/mol. Its IUPAC name is methyl (2S)-2-cyclohexyl-2-[[2-[(2,6-dimethyl-4-prop-2-enylphenyl)carbamoylamino]-4-fluorobenzoyl]amino]acetate.
| Compound Name | methyl (2S)-2-cyclohexyl-2-[[2-[(2,6-dimethyl-4-prop-2-enylphenyl)carbamoylamino]-4-fluorobenzoyl]amino]acetate |
|---|---|
| PubChem CID | 91181051 |
| Molecular Formula | C28H34FN3O4 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | methyl (2S)-2-cyclohexyl-2-[[2-[(2,6-dimethyl-4-prop-2-enylphenyl)carbamoylamino]-4-fluorobenzoyl]amino]acetate |
| SMILES | C=CCc1cc(C)c(NC(=O)Nc2cc(F)ccc2C(=O)N[C@H](C(=O)OC)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C28H34FN3O4/c1-5-9-19-14-17(2)24(18(3)15-19)32-28(35)30-23-16-21(29)12-13-22(23)26(33)31-25(27(34)36-4)20-10-7-6-8-11-20/h5,12-16,20,25H,1,6-11H2,2-4H3,(H,31,33)(H2,30,32,35)/t25-/m0/s1 |
| InChIKey | CYHRNYVAVRHIQW-VWLOTQADSA-N |
| XLogP | 5.67 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|